CAS 885273-45-0
:6-(3,6-Dihydro-2H-pyran-4-yl)-1H-indole
Description:
6-(3,6-Dihydro-2H-pyran-4-yl)-1H-indole, with the CAS number 885273-45-0, is a chemical compound that features a fused indole and dihydropyran structure. This compound typically exhibits characteristics common to indole derivatives, such as potential biological activity, including anti-inflammatory and anticancer properties. The presence of the dihydropyran moiety may enhance its solubility and reactivity, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with a specific melting point that can vary based on purity and crystalline form. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic substitutions and cycloadditions, due to the electron-rich nature of the indole ring. Additionally, the compound's functional groups may influence its interaction with biological targets, making it a candidate for further pharmacological studies. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-2-12(10-4-7-15-8-5-10)9-13-11(1)3-6-14-13/h1-4,6,9,14H,5,7-8H2
InChI key:InChIKey=JIXQUDUYFRKOIC-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)C=CN2)C=3CCOCC3
Synonyms:- 6-(3,6-Dihydro-2H-Pyran-4-Yl)-1H-Indole
- 1H-Indole, 6-(3,6-dihydro-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
