CymitQuimica logo

CAS 885273-46-1

:

2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxaldehyde

Description:
2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxaldehyde, with the CAS number 885273-46-1, is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde functional group. The benzodioxole structure contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. The oxazole ring can enhance its chemical reactivity, making it a candidate for further derivatization in synthetic chemistry. Additionally, compounds of this nature may exhibit fluorescence or other optical properties, which can be useful in applications such as imaging or sensing. Overall, 2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxaldehyde represents a versatile scaffold for research in medicinal chemistry and materials science.
Formula:C11H7NO4
InChI:InChI=1S/C11H7NO4/c13-4-8-5-14-11(12-8)7-1-2-9-10(3-7)16-6-15-9/h1-5H,6H2
InChI key:InChIKey=LKKAPSMWLSOIEN-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(C=2C=C3C(=CC2)OCO3)OC1
Synonyms:
  • 2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxaldehyde
  • 2-Benzo[1,3]Dioxol-5-Yl-Oxazole-4-Carbaldehyde
  • 4-Oxazolecarboxaldehyde, 2-(1,3-benzodioxol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.