CAS 885273-47-2
:Tetrahydro-4-(1H-indol-6-yl)-2H-pyran-4-ol
Description:
Tetrahydro-4-(1H-indol-6-yl)-2H-pyran-4-ol, with the CAS number 885273-47-2, is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring fused with an indole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. It may possess various functional groups that can influence its solubility, reactivity, and interaction with biological targets. The presence of the indole structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to indole's known roles in various biological processes. Additionally, the compound's stereochemistry can significantly affect its pharmacological properties, making it a subject of interest in drug design and development. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H15NO2
InChI:InChI=1S/C13H15NO2/c15-13(4-7-16-8-5-13)11-2-1-10-3-6-14-12(10)9-11/h1-3,6,9,14-15H,4-5,7-8H2
InChI key:InChIKey=FEKRJXVGUXPGHT-UHFFFAOYSA-N
SMILES:OC1(CCOCC1)C=2C=C3C(=CC2)C=CN3
Synonyms:- 4-(1H-INDOL-6-YL)-TETRAHYDRO-PYRAN-4-OL
- 4-(1H-INDOL-6-YL)-TETRAHYDRO-2H-PYRAN-4-OL
- Tetrahydro-4-(1H-indol-6-yl)-2H-pyran-4-ol
- 2H-Pyran-4-ol, tetrahydro-4-(1H-indol-6-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
