
CAS 885273-49-4
:6-(4-Pyridinyl)-1H-indole
Description:
6-(4-Pyridinyl)-1H-indole, identified by its CAS number 885273-49-4, is a chemical compound that features a fused indole and pyridine structure, which contributes to its unique properties. This compound typically exhibits a solid-state at room temperature and is characterized by its aromatic nature, which can influence its reactivity and interactions with other molecules. The presence of the pyridine ring introduces nitrogen into the structure, potentially enhancing its solubility in polar solvents and affecting its electronic properties. 6-(4-Pyridinyl)-1H-indole may exhibit biological activity, making it of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways. Its molecular structure allows for various functionalizations, which can be explored for the synthesis of derivatives with tailored properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound represents a versatile scaffold for further research and development in various chemical and pharmaceutical fields.
Formula:C13H10N2
InChI:InChI=1S/C13H10N2/c1-2-12(10-3-6-14-7-4-10)9-13-11(1)5-8-15-13/h1-9,15H
InChI key:InChIKey=FOCQQVWHCPIMHK-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)C=CN2)C=3C=CN=CC3
Synonyms:- 1H-Indole, 6-(4-pyridinyl)-
- 6-(4-Pyridinyl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
