CAS 885273-50-7
:3-(3-Chlorophenyl)-5-isoxazolemethanamine
Description:
3-(3-Chlorophenyl)-5-isoxazolemethanamine, identified by its CAS number 885273-50-7, is a chemical compound that features a unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound is characterized by the presence of a chlorophenyl group, which contributes to its potential biological activity and lipophilicity. The isoxazole moiety is known for its role in various pharmacological applications, often exhibiting properties such as anti-inflammatory, analgesic, or antimicrobial effects. The amine functional group in the structure suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the presence of the chlorine atom can enhance the compound's stability and alter its electronic properties, potentially affecting its interaction with biological targets. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c11-8-3-1-2-7(4-8)10-5-9(6-12)14-13-10/h1-5H,6,12H2
InChI key:InChIKey=HEGWLLFZCBEGJE-UHFFFAOYSA-N
SMILES:C(N)C1=CC(=NO1)C2=CC(Cl)=CC=C2
Synonyms:- 1-[3-(3-Chlorophenyl)-1,2-oxazol-5-yl]methanamine
- 3-(3-Chlorophenyl)-5-isoxazolemethanamine
- 3-m-Chlorophenyl-5-aminomethyl-isoxazole
- 5-Isoxazolemethanamine, 3-(3-chlorophenyl)-
- [3-(3-Chlorophenyl)-1,2-oxazol-5-yl]methanamine
- [3-(3-Chlorophenyl)-isoxazol-5-yl]-methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
