CAS 885273-51-8
:Methyl 3-formyl-5-methoxy-1H-indole-2-carboxylate
Description:
Methyl 3-formyl-5-methoxy-1H-indole-2-carboxylate, identified by its CAS number 885273-51-8, is a chemical compound belonging to the indole family, which is characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a formyl group (-CHO) and a methoxy group (-OCH3) attached to the indole structure, contributing to its unique reactivity and potential biological activity. The presence of the carboxylate group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity in various chemical environments. Methyl 3-formyl-5-methoxy-1H-indole-2-carboxylate may exhibit interesting properties such as fluorescence or potential pharmacological effects, making it a subject of interest in medicinal chemistry and organic synthesis. Its structural features suggest it could participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, which are common in the synthesis of more complex organic molecules.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-16-7-3-4-10-8(5-7)9(6-14)11(13-10)12(15)17-2/h3-6,13H,1-2H3
InChI key:InChIKey=WMMXFTKKHZYAOL-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1C(OC)=O)=CC=C(OC)C2
Synonyms:- Methyl 3-formyl-5-methoxy-1H-indole-2-carboxylate
- 1H-Indole-2-carboxylic acid, 3-formyl-5-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
