CAS 885273-53-0
:Ethyl 3-formyl-7-nitro-1H-indole-2-carboxylate
Description:
Ethyl 3-formyl-7-nitro-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a formyl group (-CHO) and a nitro group (-NO2) at specific positions on the indole ring, contributing to its reactivity and potential biological activity. The ethyl ester functional group (-COOEt) enhances its solubility in organic solvents, making it useful in various synthetic applications. The presence of the nitro group often indicates potential for biological activity, as nitro-substituted compounds can exhibit antimicrobial or anticancer properties. Additionally, the carboxylate moiety can participate in various chemical reactions, including esterification and amidation. Overall, Ethyl 3-formyl-7-nitro-1H-indole-2-carboxylate is of interest in medicinal chemistry and organic synthesis due to its unique structural features and potential applications in drug development.
Formula:C12H10N2O5
InChI:InChI=1S/C12H10N2O5/c1-2-19-12(16)11-8(6-15)7-4-3-5-9(14(17)18)10(7)13-11/h3-6,13H,2H2,1H3
InChI key:InChIKey=HAUUYXMEVVDDBB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(C=O)=C(C(OCC)=O)N2)=CC=C1
Synonyms:- Ethyl 3-formyl-7-nitro-1H-indole-2-carboxylate
- 1H-Indole-2-carboxylic acid, 3-formyl-7-nitro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
