CAS 885273-54-1
:3-(3-Methylphenyl)-5-isoxazolecarboxaldehyde
Description:
3-(3-Methylphenyl)-5-isoxazolecarboxaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the 3-methylphenyl group contributes to its hydrophobic characteristics and may influence its solubility and interaction with biological systems. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The isoxazole moiety is known for its role in various pharmacological activities, and the aldehyde group can participate in further chemical reactions, such as condensation or reduction. Overall, 3-(3-Methylphenyl)-5-isoxazolecarboxaldehyde is a versatile compound that may serve as a valuable intermediate in the synthesis of more complex molecules or as a potential lead compound in drug discovery.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-8-3-2-4-9(5-8)11-6-10(7-13)14-12-11/h2-7H,1H3
InChI key:InChIKey=DXQBKEWQAXECRX-UHFFFAOYSA-N
SMILES:C(=O)C1=CC(=NO1)C2=CC(C)=CC=C2
Synonyms:- 3-(3-Methylphenyl)-1,2-Oxazole-5-Carbaldehyde
- 3-(3-Methylphenyl)-1,2-oxazol-5-carbaldehyd
- 3-(3-Methylphenyl)-5-isoxazolecarboxaldehyde
- 5-Isoxazolecarboxaldehyde, 3-(3-Methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
