CAS 885273-68-7
:3-(4-Ethylphenyl)-5-isoxazolemethanol
Description:
3-(4-Ethylphenyl)-5-isoxazolemethanol is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. The presence of the ethylphenyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound features a hydroxymethyl group, which may participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Isoxazoles are known for their diverse pharmacological properties, including anti-inflammatory and analgesic effects, making this compound of interest in medicinal chemistry. The specific arrangement of atoms and functional groups in 3-(4-Ethylphenyl)-5-isoxazolemethanol suggests it may exhibit unique properties that could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated through experimental studies to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c1-2-9-3-5-10(6-4-9)12-7-11(8-14)15-13-12/h3-7,14H,2,8H2,1H3
InChI key:InChIKey=ATKDQLVYVLVRAL-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=NO1)C2=CC=C(CC)C=C2
Synonyms:- 5-Isoxazolemethanol, 3-(4-ethylphenyl)-
- [3-(4-Ethylphenyl)-1,2-oxazol-5-yl]methanol
- 3-(4-Ethylphenyl)-5-isoxazolemethanol
- [3-(4-Ethyl-phenyl)-isoxazol-5-yl]-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
