CAS 885273-72-3
:3-(3,4-dimethylphenyl)isoxazole-5-carbaldehyde
Description:
3-(3,4-Dimethylphenyl)isoxazole-5-carbaldehyde is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features a carbaldehyde functional group, indicating the presence of an aldehyde (-CHO) moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 3,4-dimethylphenyl substituent enhances its hydrophobic character and may influence its biological activity. Isoxazoles are known for their diverse pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the compound's unique features, such as its specific functional groups and substituents, may allow for various chemical reactions, including nucleophilic additions and condensation reactions. Overall, 3-(3,4-dimethylphenyl)isoxazole-5-carbaldehyde represents a versatile building block in synthetic organic chemistry.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c1-8-3-4-10(5-9(8)2)12-6-11(7-14)15-13-12/h3-7H,1-2H3
SMILES:Cc1ccc(cc1C)c1cc(C=O)on1
Synonyms:- 3-(3,4-Dimethylphenyl)-1,2-oxazole-5-carbaldehyde
- 5-Isoxazolecarboxaldehyde, 3-(3,4-Dimethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
