CAS 885273-74-5
:2-(3,5-Dimethylphenyl)-4-oxazolecarboxylic acid
Description:
2-(3,5-Dimethylphenyl)-4-oxazolecarboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 3,5-dimethylphenyl substituent enhances its hydrophobic character and may influence its biological activity and solubility in organic solvents. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents and the electronic effects they impart. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-7-3-8(2)5-9(4-7)11-13-10(6-16-11)12(14)15/h3-6H,1-2H3,(H,14,15)
InChI key:InChIKey=KHLSBMPNVRRFHD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(OC1)C2=CC(C)=CC(C)=C2
Synonyms:- 4-Oxazolecarboxylic acid, 2-(3,5-dimethylphenyl)-
- 2-(3,5-Dimethylphenyl)-4-oxazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
