CymitQuimica logo

CAS 885273-80-3

:

2-(4-Fluorophenyl)-4-oxazolemethanol

Description:
2-(4-Fluorophenyl)-4-oxazolemethanol, identified by its CAS number 885273-80-3, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's electronic properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, and its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The hydroxymethyl group (-CH2OH) contributes to its reactivity, allowing for further derivatization or interaction with biological targets. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable candidate for drug design. Overall, 2-(4-Fluorophenyl)-4-oxazolemethanol is of interest for its unique structural features and potential biological activities, warranting further investigation in various chemical and pharmaceutical contexts.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c11-8-3-1-7(2-4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=DBOXJDSKFBARHM-UHFFFAOYSA-N
SMILES:C(O)C=1N=C(OC1)C2=CC=C(F)C=C2
Synonyms:
  • 2-(4-Fluorophenyl)-4-oxazolemethanol
  • [2-(4-Fluoro-Phenyl)-Oxazol-4-Yl]-Methanol
  • [2-(4-Fluorophenyl)-1,3-oxazol-4-yl]methanol
  • [2-(4-Fluorophenyl)oxazol-4-yl]methanol
  • 4-Oxazolemethanol, 2-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.