CAS 885273-86-9
:2-(3-Methyl-4-nitrophenyl)-4-oxazolecarboxylic acid
Description:
2-(3-Methyl-4-nitrophenyl)-4-oxazolecarboxylic acid is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a nitro group at the 4-position of the phenyl ring and a methyl group at the 3-position indicates that it has both electron-withdrawing and electron-donating substituents, which can influence its reactivity and solubility. The compound is likely to exhibit moderate polarity due to the carboxylic acid group, making it soluble in polar solvents. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. Additionally, the presence of the nitro group may impart unique electronic properties, making it a candidate for further chemical modifications or studies in medicinal chemistry. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical applications.
Formula:C11H8N2O5
InChI:InChI=1S/C11H8N2O5/c1-6-4-7(2-3-9(6)13(16)17)10-12-8(5-18-10)11(14)15/h2-5H,1H3,(H,14,15)
InChI key:InChIKey=GYXVJNGQMNJIRE-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1N(=O)=O)C2=NC(C(O)=O)=CO2
Synonyms:- 2-(3-Methyl-4-Nitro-Phenyl)-Oxazole-4-Carboxylic Acid
- 2-(3-Methyl-4-nitrophenyl)-4-oxazolecarboxylic acid
- 4-Oxazolecarboxylic acid, 2-(3-methyl-4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
