CAS 885273-88-1
:2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxylic acid
Description:
2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxylic acid, with the CAS number 885273-88-1, is a chemical compound characterized by its unique structural features, which include a benzodioxole moiety and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, and may exhibit acidic properties due to the carboxylic acid functional group. The presence of the benzodioxole structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as this moiety is often associated with various biological activities. Additionally, the oxazole ring may impart specific reactivity and stability characteristics, making it a subject of interest in synthetic organic chemistry. Overall, this compound's unique structure and functional groups position it as a potentially valuable entity in research and development within the fields of chemistry and pharmacology.
Formula:C11H7NO5
InChI:InChI=1S/C11H7NO5/c13-11(14)7-4-15-10(12-7)6-1-2-8-9(3-6)17-5-16-8/h1-4H,5H2,(H,13,14)
InChI key:InChIKey=UACXQAZNLXMPKB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(C=2C=C3C(=CC2)OCO3)OC1
Synonyms:- 2-(1,3-Benzodioxol-5-yl)-4-oxazolecarboxylic acid
- 2-Benzo[1,3]Dioxol-5-Yl-Oxazole-4-Carboxylic Acid
- 4-Oxazolecarboxylic acid, 2-(1,3-benzodioxol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
