CAS 885273-94-9
:2-(2-Ethylphenyl)-4-oxazolemethanamine
Description:
2-(2-Ethylphenyl)-4-oxazolemethanamine, with the CAS number 885273-94-9, is a chemical compound characterized by its unique structure, which includes an oxazole ring and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the ethylphenyl group may enhance lipophilicity, influencing its solubility in organic solvents and its interaction with biological membranes. The oxazole ring can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis. Additionally, compounds with similar structures have been studied for their pharmacological properties, including potential applications in medicinal chemistry. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through experimental studies and literature reviews. Overall, 2-(2-Ethylphenyl)-4-oxazolemethanamine represents an interesting compound for research in both synthetic and medicinal chemistry.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-2-9-5-3-4-6-11(9)12-14-10(7-13)8-15-12/h3-6,8H,2,7,13H2,1H3
InChI key:InChIKey=SPOCJGXPMIHIFN-UHFFFAOYSA-N
SMILES:C(C)C1=C(C=CC=C1)C2=NC(CN)=CO2
Synonyms:- 2-(2-Ethyl-Phenyl)-Oxazol-4-Yl-Methylamine
- 2-(2-Ethylphenyl)-4-oxazolemethanamine
- C-[2-(2-Ethyl-Phenyl)-Oxazol-4-Yl]-Methylamine
- 4-Oxazolemethanamine, 2-(2-ethylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
