CymitQuimica logo

CAS 885274-00-0

:

2-(2-Fluorophenyl)-4-oxazolemethanol

Description:
2-(2-Fluorophenyl)-4-oxazolemethanol is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's electronic properties and reactivity. The hydroxymethyl group (-CH2OH) attached to the oxazole ring suggests potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure could contribute to specific interactions with biological targets, potentially leading to therapeutic applications. Additionally, the fluorine substitution can enhance lipophilicity and metabolic stability. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed, as with all chemical substances, particularly in research and industrial applications.
Formula:C10H8FNO2
InChI:InChI=1S/C10H8FNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=SSHSJSFKUJWMKY-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC(CO)=CO2)C=CC=C1
Synonyms:
  • 2-(2-Fluorophenyl)-4-oxazolemethanol
  • [2-(2-Fluoro-Phenyl)-Oxazol-4-Yl]-Methanol
  • 4-Oxazolemethanol, 2-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.