CAS 885274-02-2
:2-(2-Bromophenyl)-4-oxazolemethanol
Description:
2-(2-Bromophenyl)-4-oxazolemethanol is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's potential reactivity and biological activity. The hydroxymethyl group (-CH2OH) attached to the oxazole ring suggests that the compound may exhibit properties typical of alcohols, such as hydrogen bonding capabilities. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, the bromine substituent can enhance lipophilicity and may play a role in the compound's interaction with biological targets. Overall, 2-(2-Bromophenyl)-4-oxazolemethanol presents a unique combination of functional groups that could be explored for various applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,6,13H,5H2
InChI key:InChIKey=HRKGJMOUAJGHTD-UHFFFAOYSA-N
SMILES:BrC1=C(C2=NC(CO)=CO2)C=CC=C1
Synonyms:- 2-(2-Bromophenyl)-4-oxazolemethanol
- [2-(2-Bromo-Phenyl)-Oxazol-4-Yl]-Methanol
- 4-Oxazolemethanol, 2-(2-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
