CAS 885274-04-4
:2-(2-Methylphenyl)-4-oxazolemethanol
Description:
2-(2-Methylphenyl)-4-oxazolemethanol, identified by its CAS number 885274-04-4, is a chemical compound that features an oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound is characterized by the presence of a hydroxymethyl group (-CH2OH) attached to the oxazole ring, as well as a 2-methylphenyl substituent, which contributes to its aromatic properties. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with oxazole derivatives. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the specific conditions under which it is studied. Additionally, its synthesis may involve standard organic reactions such as condensation or cyclization. As with many organic compounds, safety data and handling precautions should be considered, especially regarding its potential toxicity and environmental impact.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-8-4-2-3-5-10(8)11-12-9(6-13)7-14-11/h2-5,7,13H,6H2,1H3
InChI key:InChIKey=HDQIBOILSFYROR-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC(CO)=CO2)C=CC=C1
Synonyms:- (2-O-Tolyl-Oxazol-4-Yl)-Methanol
- 2-(2-Methylphenyl)-4-oxazolemethanol
- 4-Oxazolemethanol, 2-(2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
