CymitQuimica logo

CAS 885274-14-6

:

4-[(1,1-Dimethylethoxy)carbonyl]-α-(2-nitrophenyl)-1-piperazineacetic acid

Description:
4-[(1,1-Dimethylethoxy)carbonyl]-α-(2-nitrophenyl)-1-piperazineacetic acid, with the CAS number 885274-14-6, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The 1,1-dimethylethoxycarbonyl group serves as a protective or modifying group, influencing the compound's solubility and stability. Additionally, the presence of a nitrophenyl group introduces electron-withdrawing characteristics, which can affect the compound's electronic properties and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals, where modifications to piperazine derivatives are common for enhancing therapeutic efficacy. Overall, the compound's unique combination of functional groups and structural elements contributes to its chemical behavior and potential applications.
Formula:C17H23N3O6
InChI:InChI=1S/C17H23N3O6/c1-17(2,3)26-16(23)19-10-8-18(9-11-19)14(15(21)22)12-6-4-5-7-13(12)20(24)25/h4-7,14H,8-11H2,1-3H3,(H,21,22)
InChI key:InChIKey=HVUYNHZESWWKLB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=C(N(=O)=O)C=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-(2-nitrophenyl)-
  • 4-[(1,1-Dimethylethoxy)carbonyl]-α-(2-nitrophenyl)-1-piperazineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.