CAS 885274-15-7
:2-(2-Bromophenyl)-4-oxazolemethanamine
Description:
2-(2-Bromophenyl)-4-oxazolemethanamine, identified by its CAS number 885274-15-7, is a chemical compound that features a unique structure combining an oxazole ring with a bromophenyl group and an amine functional group. This compound typically exhibits characteristics associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the amine group, which can participate in hydrogen bonding and other interactions. The bromine substituent on the phenyl ring may influence its reactivity and solubility, as halogens can affect the electronic properties of the aromatic system. Additionally, the oxazole ring contributes to the compound's stability and may impart specific pharmacological properties. Such compounds are often of interest in medicinal chemistry for their potential applications in drug development, particularly in targeting various biological pathways. Overall, the characteristics of 2-(2-Bromophenyl)-4-oxazolemethanamine suggest it may be a valuable compound for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c11-9-4-2-1-3-8(9)10-13-7(5-12)6-14-10/h1-4,6H,5,12H2
InChI key:InChIKey=BQLZVHZBEXKIGJ-UHFFFAOYSA-N
SMILES:BrC1=C(C2=NC(CN)=CO2)C=CC=C1
Synonyms:- 2-(2-Bromo-Phenyl)-Oxazol-4-Yl-Methylamine
- 2-(2-Bromophenyl)-4-oxazolemethanamine
- C-[2-(2-Bromo-Phenyl)-Oxazol-4-Yl]-Methylamine
- 4-Oxazolemethanamine, 2-(2-bromophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
