CymitQuimica logo

CAS 885274-17-9

:

4-[(1,1-Dimethylethoxy)carbonyl]-α-(3-nitrophenyl)-1-piperazineacetic acid

Description:
4-[(1,1-Dimethylethoxy)carbonyl]-α-(3-nitrophenyl)-1-piperazineacetic acid, with the CAS number 885274-17-9, is a chemical compound that features a piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a nitrophenyl group, which contributes to its potential biological activity and reactivity. The dimethylethoxycarbonyl group serves as a protective or modifying moiety, influencing the compound's solubility and stability. The carboxylic acid functional group at the end of the piperazine chain is significant for its acid-base properties and potential interactions in biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C17H23N3O6
InChI:InChI=1S/C17H23N3O6/c1-17(2,3)26-16(23)19-9-7-18(8-10-19)14(15(21)22)12-5-4-6-13(11-12)20(24)25/h4-6,11,14H,7-10H2,1-3H3,(H,21,22)
InChI key:InChIKey=PNYKVACQPIQWMX-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC(N(=O)=O)=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-(3-nitrophenyl)-
  • 4-[(1,1-Dimethylethoxy)carbonyl]-α-(3-nitrophenyl)-1-piperazineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.