CAS 885274-19-1
:2-[[(1,1-Dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-6-methoxy-2-naphthalenecarboxylic acid
Description:
2-[[(1,1-Dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-6-methoxy-2-naphthalenecarboxylic acid, with CAS number 885274-19-1, is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and multiple functional groups. This compound features an amino group, a carboxylic acid, and an ether moiety, contributing to its potential reactivity and solubility properties. The presence of the dimethylethoxycarbonyl group suggests that it may be used as a protecting group in organic synthesis. The tetrahydro configuration indicates that the compound is a saturated derivative of naphthalene, which may influence its biological activity and interaction with other molecules. Additionally, the methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C17H23NO5
InChI:InChI=1S/C17H23NO5/c1-16(2,3)23-15(21)18-17(14(19)20)8-7-11-9-13(22-4)6-5-12(11)10-17/h5-6,9H,7-8,10H2,1-4H3,(H,18,21)(H,19,20)
InChI key:InChIKey=RNMUFHRLLMSOHE-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1(C(O)=O)CC=2C(CC1)=CC(OC)=CC2
Synonyms:- 2-Naphthalenecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-6-methoxy-
- 2-BOC-AMINO-6-METHOXY-1,2,3,4-TETRAHYDRO-NAPHTHALENE-2-CARBOXYLIC ACID
- 2-[[(1,1-Dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-6-methoxy-2-naphthalenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[[(1,1-Dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-6-methoxy-2-naphthalenecarboxylic acid
CAS:Formula:C17H23NO5Molecular weight:321.3682
