
CAS 885274-20-4
:4-[(1,1-Dimethylethoxy)carbonyl]-α-(4-nitrophenyl)-1-piperazineacetic acid
Description:
4-[(1,1-Dimethylethoxy)carbonyl]-α-(4-nitrophenyl)-1-piperazineacetic acid, with CAS number 885274-20-4, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a nitrophenyl group, and an acetic acid moiety. This compound typically exhibits properties associated with both basic and acidic functional groups, allowing it to participate in various chemical reactions. The presence of the nitro group suggests potential for electrophilic reactivity, while the piperazine ring contributes to its potential biological activity, often seen in pharmaceuticals. The dimethylethoxycarbonyl group serves as a protective or modifying group, influencing the compound's solubility and stability. In terms of applications, compounds of this nature may be explored in medicinal chemistry for their potential therapeutic effects, particularly in the development of drugs targeting neurological or psychiatric conditions. Overall, the unique combination of functional groups in this compound suggests a versatile profile for further research and application in chemical and pharmaceutical sciences.
Formula:C17H23N3O6
InChI:InChI=1S/C17H23N3O6/c1-17(2,3)26-16(23)19-10-8-18(9-11-19)14(15(21)22)12-4-6-13(7-5-12)20(24)25/h4-7,14H,8-11H2,1-3H3,(H,21,22)
InChI key:InChIKey=ROSDMOMFZWIXBB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCN(C(OC(C)(C)C)=O)CC1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 4-[(1,1-Dimethylethoxy)carbonyl]-α-(4-nitrophenyl)-1-piperazineacetic acid
- 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-(4-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.