CymitQuimica logo

CAS 885274-23-7

:

4-[(1,1-Dimethylethoxy)carbonyl]-α-[2-(trifluoromethyl)phenyl]-1-piperazineacetic acid

Description:
4-[(1,1-Dimethylethoxy)carbonyl]-α-[2-(trifluoromethyl)phenyl]-1-piperazineacetic acid, with CAS number 885274-23-7, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring, an acetic acid moiety, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential bioactivity due to its piperazine core, which is often associated with pharmacological effects. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's interaction with biological targets. Additionally, the dimethylethoxycarbonyl group serves as a protective or modifying group, which can affect the compound's reactivity and stability. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the design of novel therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or detailed literature reference for precise values.
Formula:C18H23F3N2O4
InChI:InChI=1S/C18H23F3N2O4/c1-17(2,3)27-16(26)23-10-8-22(9-11-23)14(15(24)25)12-6-4-5-7-13(12)18(19,20)21/h4-7,14H,8-11H2,1-3H3,(H,24,25)
InChI key:InChIKey=IYIQZDBAVIZZOC-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=C(C(F)(F)F)C=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-[2-(trifluoromethyl)phenyl]-
  • 4-[(1,1-Dimethylethoxy)carbonyl]-α-[2-(trifluoromethyl)phenyl]-1-piperazineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.