CAS 885274-25-9
:2-Oxazolecarbothioamide
Description:
2-Oxazolecarbothioamide is a heterocyclic compound characterized by the presence of an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. This compound features a carbothioamide functional group, which includes a carbon atom double-bonded to sulfur and single-bonded to an amine group. The structure contributes to its potential reactivity and biological activity. Typically, compounds like 2-Oxazolecarbothioamide may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making them of interest in medicinal chemistry. The presence of the oxazole ring can also influence the compound's solubility, stability, and interaction with biological targets. Additionally, the specific arrangement of atoms and functional groups can lead to unique spectroscopic characteristics, which can be analyzed using techniques such as NMR and IR spectroscopy. Overall, 2-Oxazolecarbothioamide represents a class of compounds that may have significant applications in pharmaceuticals and agrochemicals due to their diverse chemical properties.
Formula:C4H4N2OS
InChI:InChI=1S/C4H4N2OS/c5-3(8)4-6-1-2-7-4/h1-2H,(H2,5,8)
InChI key:InChIKey=HYCQTQGTVIOIKJ-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=NC=CO1
Synonyms:- 1,3-Oxazole-2-carbothioamide
- Oxazole-2-Carbothioic Acid Amide
- 2-Oxazolecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
