CymitQuimica logo

CAS 885274-26-0

:

4-[(1,1-Dimethylethoxy)carbonyl]-α-[3-(trifluoromethyl)phenyl]-1-piperazineacetic acid

Description:
4-[(1,1-Dimethylethoxy)carbonyl]-α-[3-(trifluoromethyl)phenyl]-1-piperazineacetic acid is a chemical compound characterized by its complex structure, which includes a piperazine ring, a trifluoromethyl-substituted phenyl group, and an acetic acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a protective group that can influence its reactivity and solubility. This compound is likely to exhibit properties typical of piperazine derivatives, such as potential biological activity, making it of interest in medicinal chemistry. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, which can affect the pharmacokinetics of the compound. Additionally, the presence of the carboxylic acid functional group suggests that it can participate in hydrogen bonding and may exhibit acidic properties. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C18H23F3N2O4
InChI:InChI=1S/C18H23F3N2O4/c1-17(2,3)27-16(26)23-9-7-22(8-10-23)14(15(24)25)12-5-4-6-13(11-12)18(19,20)21/h4-6,11,14H,7-10H2,1-3H3,(H,24,25)
InChI key:InChIKey=VDAYHHAPFFLENF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC(C(F)(F)F)=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Piperazineacetic acid, 4-[(1,1-dimethylethoxy)carbonyl]-α-[3-(trifluoromethyl)phenyl]-
  • 2-(4-Boc-Piperazinyl)-2-(3-Trifluoromethyl-Phenyl)Acetic Acid
  • 4-[(1,1-Dimethylethoxy)carbonyl]-α-[3-(trifluoromethyl)phenyl]-1-piperazineacetic acid
  • Alpha-(4-Boc-Piperazinyl)-Alpha-(3-Trifluoromethylphenyl)Acetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.