CAS 885274-29-3
:2-(2-Methoxyphenyl)-4-oxazolemethanamine
Description:
2-(2-Methoxyphenyl)-4-oxazolemethanamine, identified by its CAS number 885274-29-3, is a chemical compound that features a unique structure combining an oxazole ring with an amine group. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxyphenyl group contributes to its aromatic properties, potentially influencing its electronic characteristics and interactions with biological targets. Compounds of this nature may be of interest in medicinal chemistry, particularly for their potential pharmacological activities, including anti-inflammatory or anticancer properties. Additionally, the oxazole moiety can enhance the compound's stability and lipophilicity, making it suitable for various applications in drug development. As with any chemical substance, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c1-14-10-5-3-2-4-9(10)11-13-8(6-12)7-15-11/h2-5,7H,6,12H2,1H3
InChI key:InChIKey=TXBCINNTTCDAHN-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=NC(CN)=CO2
Synonyms:- 2-(2-Methoxy-Phenyl)-Oxazol-4-Yl-Methylamine
- 2-(2-Methoxyphenyl)-4-oxazolemethanamine
- C-[2-(2-Methoxy-Phenyl)-Oxazol-4-Yl]-Methylamine
- 4-Oxazolemethanamine, 2-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
