CymitQuimica logo

CAS 885274-34-0

:

2-(2-Bromophenyl)-4-oxazolecarboxaldehyde

Description:
2-(2-Bromophenyl)-4-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's reactivity and potential applications in various chemical reactions. The aldehyde functional group (-CHO) attached to the oxazole ring is significant for its reactivity, particularly in condensation reactions and as a precursor for further synthetic transformations. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as solubility, melting point, and stability, can vary based on the specific conditions and solvents used. Additionally, the presence of the bromine atom can influence the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Overall, 2-(2-Bromophenyl)-4-oxazolecarboxaldehyde is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C10H6BrNO2
InChI:InChI=1S/C10H6BrNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-6H
InChI key:InChIKey=KRISPNBRAADPAI-UHFFFAOYSA-N
SMILES:BrC1=C(C2=NC(C=O)=CO2)C=CC=C1
Synonyms:
  • 2-(2-Bromo-Phenyl)-Oxazole-4-Carbaldehyde
  • 2-(2-Bromophenyl)-4-oxazolecarboxaldehyde
  • 4-Oxazolecarboxaldehyde, 2-(2-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.