CAS 885274-39-5
:2-(2-Fluorophenyl)-4-oxazolemethanamine
Description:
2-(2-Fluorophenyl)-4-oxazolemethanamine, identified by its CAS number 885274-39-5, is a chemical compound characterized by its unique structural features, which include an oxazole ring and an amine group. The presence of the fluorophenyl moiety suggests that it may exhibit interesting electronic properties and potential biological activity. Typically, compounds of this nature can be involved in various chemical reactions due to the reactivity of the amine group, which can participate in nucleophilic substitutions or form hydrogen bonds. The oxazole ring contributes to the compound's stability and may influence its solubility and interaction with biological targets. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry and drug development. Overall, the characteristics of 2-(2-Fluorophenyl)-4-oxazolemethanamine suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.
Formula:C10H9FN2O
InChI:InChI=1S/C10H9FN2O/c11-9-4-2-1-3-8(9)10-13-7(5-12)6-14-10/h1-4,6H,5,12H2
InChI key:InChIKey=ACJXATLXJAQYIV-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC(CN)=CO2)C=CC=C1
Synonyms:- 2-(2-Fluorophenyl)-4-oxazolemethanamine
- 4-Oxazolemethanamine, 2-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2-Fluorophenyl)-N-methyl-1,3-oxazol-4-amine
CAS:<p>2-(2-Fluorophenyl)-N-methyl-1,3-oxazol-4-amine</p>Molecular weight:192.18966g/mol


