CAS 885274-40-8
:4-[2-(Cyclopropyloxy)ethoxy]phenol
Description:
4-[2-(Cyclopropyloxy)ethoxy]phenol, with the CAS number 885274-40-8, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of the cyclopropyloxy and ethoxy substituents contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The cyclopropyl group introduces strain and can influence the compound's reactivity and steric properties. Additionally, the ethoxy group may enhance lipophilicity, affecting the compound's biological activity and potential applications in pharmaceuticals or agrochemicals. The compound's structure suggests potential uses in various chemical syntheses or as an intermediate in the development of more complex molecules. However, specific data on its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise characterization.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c12-9-1-3-10(4-2-9)13-7-8-14-11-5-6-11/h1-4,11-12H,5-8H2
InChI key:InChIKey=ZEYQIVSXHSQFJQ-UHFFFAOYSA-N
SMILES:O(CCOC1=CC=C(O)C=C1)C2CC2
Synonyms:- 4-(2-Cyclopropoxy-Ethoxy)-Phenol
- 4-[2-(Cyclopropyloxy)ethoxy]phenol
- Phenol, 4-[2-(cyclopropyloxy)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
