CymitQuimica logo

CAS 885274-44-2

:

1,1-Dimethylethyl 4-(cyclooctylamino)-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-(cyclooctylamino)-1-piperidinecarboxylate, identified by its CAS number 885274-44-2, is a chemical compound that features a piperidine ring substituted with a cyclooctylamino group and an ester functional group. This compound is characterized by its relatively complex structure, which includes a tert-butyl group (1,1-dimethylethyl) that enhances its steric bulk and may influence its reactivity and solubility. The presence of the cyclooctylamino moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its nitrogen-containing structure. The ester functionality indicates that it may undergo hydrolysis under certain conditions, leading to the release of the corresponding piperidinecarboxylic acid. Overall, the compound's unique structural features contribute to its potential utility in various chemical and biological applications, although specific properties such as solubility, melting point, and reactivity would require empirical measurement for precise characterization.
Formula:C18H34N2O2
InChI:InChI=1S/C18H34N2O2/c1-18(2,3)22-17(21)20-13-11-16(12-14-20)19-15-9-7-5-4-6-8-10-15/h15-16,19H,4-14H2,1-3H3
InChI key:InChIKey=SAIBMNAATRKEJG-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(NC2CCCCCCC2)CC1
Synonyms:
  • 1,1-Dimethylethyl 4-(cyclooctylamino)-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-(cyclooctylamino)-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.