CAS 885274-52-2
:2-(2-Aminophenyl)-4-oxazolecarboxaldehyde
Description:
2-(2-Aminophenyl)-4-oxazolecarboxaldehyde, with the CAS number 885274-52-2, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing nitrogen and oxygen. This substance features an aldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the amino group on the phenyl ring enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, 2-(2-Aminophenyl)-4-oxazolecarboxaldehyde is a versatile compound with significant implications in synthetic organic chemistry and medicinal chemistry.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-6H,11H2
InChI key:InChIKey=YLSHXAYLBUAOHB-UHFFFAOYSA-N
SMILES:NC1=C(C2=NC(C=O)=CO2)C=CC=C1
Synonyms:- 2-(2-Amino-Phenyl)-Oxazole-4-Carbaldehyde
- 2-(2-Aminophenyl)-4-oxazolecarboxaldehyde
- 4-Oxazolecarboxaldehyde, 2-(2-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
