CAS 885274-59-9
:[4-(4-piperidyl)phenyl]methanol
Description:
[4-(4-piperidyl)phenyl]methanol, identified by its CAS number 885274-59-9, is an organic compound characterized by its structure, which features a phenolic group attached to a piperidine ring. This compound typically exhibits properties such as being a white to off-white solid at room temperature. It is soluble in polar organic solvents, which is common for compounds containing hydroxyl groups. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. The hydroxyl group in [4-(4-piperidyl)phenyl]methanol can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, this compound may be of interest in the development of pharmaceuticals or as a building block in organic synthesis due to its functional groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c14-9-10-1-3-11(4-2-10)12-5-7-13-8-6-12/h1-4,12-14H,5-9H2
SMILES:c1cc(ccc1CO)C1CCNCC1
Synonyms:- [4-(Piperidin-4-yl)phenyl]methanol
- Benzenemethanol, 4-(4-Piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

