CAS 885274-64-6
:Ethyl 2-(2-methoxyphenyl)-4-oxazolecarboxylate
Description:
Ethyl 2-(2-methoxyphenyl)-4-oxazolecarboxylate is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the 2-methoxyphenyl group enhances its aromatic character and may influence its reactivity and interaction with biological systems. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The oxazole moiety can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic applications. Additionally, the compound's structure suggests potential for applications in materials science or as intermediates in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C13H13NO4
InChI:InChI=1S/C13H13NO4/c1-3-17-13(15)10-8-18-12(14-10)9-6-4-5-7-11(9)16-2/h4-8H,3H2,1-2H3
InChI key:InChIKey=JTRQRTBFGRRCJS-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=NC(C(OCC)=O)=CO2
Synonyms:- 2-(2-Methoxy-Phenyl)-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(2-methoxyphenyl)-, ethyl ester
- Ethyl 2-(2-methoxyphenyl)-4-oxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
