CAS 885274-67-9
:Ethyl 2-(2-bromophenyl)-4-oxazolecarboxylate
Description:
Ethyl 2-(2-bromophenyl)-4-oxazolecarboxylate is a chemical compound characterized by its unique structure, which includes an oxazole ring and a bromophenyl group. This compound typically exhibits properties associated with both the oxazole and ester functional groups. It is likely to be a solid at room temperature, with moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The presence of the bromine atom can impart specific reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Ethyl 2-(2-bromophenyl)-4-oxazolecarboxylate may also exhibit biological activity, which could be of interest in pharmaceutical research. Its synthesis generally involves multi-step organic reactions, and it may serve as an intermediate in the production of more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.
Formula:C12H10BrNO3
InChI:InChI=1S/C12H10BrNO3/c1-2-16-12(15)10-7-17-11(14-10)8-5-3-4-6-9(8)13/h3-7H,2H2,1H3
InChI key:InChIKey=JKNMLLKRWOENTR-UHFFFAOYSA-N
SMILES:BrC1=C(C2=NC(C(OCC)=O)=CO2)C=CC=C1
Synonyms:- 2-(2-Bromo-Phenyl)-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(2-bromophenyl)-, ethyl ester
- Ethyl 2-(2-bromophenyl)-4-oxazolecarboxylate
- 4-Oxazolecarboxylicacid, 2-(2-bromophenyl)-, ethyl ester
- ETHYL 2-(2-BROMOPHENYL)OXAZOLE-4-CARBOXYLATE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
