CymitQuimica logo

CAS 885274-69-1

:

α-(3,5-Dimethoxyphenyl)-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid

Description:
α-(3,5-Dimethoxyphenyl)-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid, with CAS number 885274-69-1, is a chemical compound characterized by its complex structure, which includes a piperazine ring, an acetic acid moiety, and a substituted phenyl group. The presence of the 3,5-dimethoxyphenyl group suggests potential for significant biological activity, as methoxy substitutions can influence the compound's interaction with biological targets. The 1,1-dimethylethoxycarbonyl group serves as a protective or modifying group, which may enhance the compound's stability or solubility. This compound is likely to exhibit properties typical of piperazine derivatives, including potential pharmacological effects, such as anxiolytic or antidepressant activities, due to the piperazine structure's known interactions with neurotransmitter systems. Additionally, the presence of multiple functional groups may allow for further chemical modifications, making it a candidate for research in medicinal chemistry. As with many synthetic compounds, its safety, efficacy, and environmental impact would need to be evaluated through rigorous testing.
Formula:C19H28N2O6
InChI:InChI=1S/C19H28N2O6/c1-19(2,3)27-18(24)21-8-6-20(7-9-21)16(17(22)23)13-10-14(25-4)12-15(11-13)26-5/h10-12,16H,6-9H2,1-5H3,(H,22,23)
InChI key:InChIKey=FUKYCGTTWYIIAR-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC(OC)=CC(OC)=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • α-(3,5-Dimethoxyphenyl)-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid
  • 1-Piperazineacetic acid, α-(3,5-dimethoxyphenyl)-4-[(1,1-dimethylethoxy)carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.