CAS 885274-70-4
:Ethyl 2-(2-chlorophenyl)-4-oxazolecarboxylate
Description:
Ethyl 2-(2-chlorophenyl)-4-oxazolecarboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 2-chlorophenyl group indicates that it has a chlorine substituent on the aromatic ring, which can influence its electronic properties and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The oxazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests potential applications in organic synthesis and material science. As with many chemical substances, safety and handling precautions are essential, as they may pose risks depending on their reactivity and toxicity profiles. Overall, Ethyl 2-(2-chlorophenyl)-4-oxazolecarboxylate represents a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C12H10ClNO3
InChI:InChI=1S/C12H10ClNO3/c1-2-16-12(15)10-7-17-11(14-10)8-5-3-4-6-9(8)13/h3-7H,2H2,1H3
InChI key:InChIKey=SYBXCOYUUMNILH-UHFFFAOYSA-N
SMILES:ClC1=C(C2=NC(C(OCC)=O)=CO2)C=CC=C1
Synonyms:- 2-(2-Chloro-Phenyl)-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(2-chlorophenyl)-, ethyl ester
- Ethyl 2-(2-chlorophenyl)-4-oxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
