CAS 885274-73-7
:4-Oxazolecarboxylic acid, 2-(3-aminophenyl)-, ethyl ester
Description:
4-Oxazolecarboxylic acid, 2-(3-aminophenyl)-, ethyl ester is a chemical compound characterized by its oxazole ring structure, which contributes to its heterocyclic properties. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it can undergo hydrolysis to release the corresponding acid. The presence of the 3-aminophenyl group suggests potential for biological activity, as amino groups can participate in hydrogen bonding and enhance solubility in polar solvents. The compound's molecular structure implies it may exhibit properties such as moderate polarity and potential reactivity due to the functional groups present. It may also be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-Oxazolecarboxylic acid, 2-(3-aminophenyl)-, ethyl ester represents a versatile structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-2-16-12(15)10-7-17-11(14-10)8-4-3-5-9(13)6-8/h3-7H,2,13H2,1H3
InChI key:InChIKey=IYMMHVKKUAJPHJ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(OC1)C2=CC(N)=CC=C2
Synonyms:- 2-(3-Amino-Phenyl)-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(3-aminophenyl)-, ethyl ester
- Ethyl 2-(3-aminophenyl)oxazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
