CAS 885274-74-8
:5-Nitro-2-(4-piperidinyl)pyridine
Description:
5-Nitro-2-(4-piperidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a piperidine group and at the 5-position with a nitro group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the nitro group typically enhances the compound's reactivity and can influence its pharmacological properties. The piperidine moiety is known for its role in various biological systems and can enhance the compound's ability to interact with biological targets. This compound may exhibit properties such as lipophilicity, which can affect its solubility and permeability in biological membranes. Additionally, the presence of both the nitro and piperidine groups suggests potential applications in drug development, particularly in the fields of neuropharmacology or as a scaffold for further chemical modifications. As with many compounds, safety and handling precautions should be observed due to the potential toxicity associated with nitro-containing compounds.
Formula:C10H13N3O2
InChI:InChI=1S/C10H13N3O2/c14-13(15)9-1-2-10(12-7-9)8-3-5-11-6-4-8/h1-2,7-8,11H,3-6H2
InChI key:InChIKey=CFGZKQZNAOGGKB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(N=C1)C2CCNCC2
Synonyms:- 5-Nitro-2-(4-piperidinyl)pyridine
- Pyridine, 5-Nitro-2-(4-Piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.