CAS 885274-76-0
:2-(3-Aminophenyl)-4-oxazolecarboxaldehyde
Description:
2-(3-Aminophenyl)-4-oxazolecarboxaldehyde is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing nitrogen and oxygen. This compound features an aldehyde functional group, which is reactive and can participate in various chemical reactions, such as condensation and oxidation. The presence of the amino group on the phenyl ring enhances its potential for forming hydrogen bonds and increases its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-(3-Aminophenyl)-4-oxazolecarboxaldehyde is a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-6H,11H2
InChI key:InChIKey=XSNSNPCJQOLUQX-UHFFFAOYSA-N
SMILES:C(=O)C=1N=C(OC1)C2=CC(N)=CC=C2
Synonyms:- 2-(3-Amino-Phenyl)-Oxazole-4-Carbaldehyde
- 2-(3-Aminophenyl)-4-oxazolecarboxaldehyde
- 4-Oxazolecarboxaldehyde, 2-(3-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
