CAS 885274-78-2
:Ethyl 2-(2-fluorophenyl)-4-oxazolecarboxylate
Description:
Ethyl 2-(2-fluorophenyl)-4-oxazolecarboxylate is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by the presence of the fluorine atom, which can enhance lipophilicity and alter the compound's behavior in biological systems. Overall, Ethyl 2-(2-fluorophenyl)-4-oxazolecarboxylate represents a class of compounds that may have significant implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H10FNO3
InChI:InChI=1S/C12H10FNO3/c1-2-16-12(15)10-7-17-11(14-10)8-5-3-4-6-9(8)13/h3-7H,2H2,1H3
InChI key:InChIKey=NGSHSERPKZUPFI-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC(C(OCC)=O)=CO2)C=CC=C1
Synonyms:- 2-(2-Fluoro-Phenyl)-Oxazole-4-Carboxylic Acid Ethyl Ester
- 4-Oxazolecarboxylic acid, 2-(2-fluorophenyl)-, ethyl ester
- Ethyl 2-(2-fluorophenyl)-4-oxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 2-(2-fluorophenyl)-1,3-oxazole-4-carboxylate
CAS:<p>Ethyl 2-(2-fluorophenyl)-1,3-oxazole-4-carboxylate</p>Molecular weight:235.2111g/mol


