CymitQuimica logo

CAS 885274-81-7

:

4-Isoxazolecarbothioamide

Description:
4-Isoxazolecarbothioamide is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a carbothioamide functional group, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to a nitrogen atom. The presence of these functional groups imparts unique chemical properties, including potential reactivity in various organic synthesis reactions. 4-Isoxazolecarbothioamide may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for interactions with biological targets, potentially leading to applications in drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many heterocycles, it may also participate in coordination chemistry, forming complexes with metal ions. Overall, 4-Isoxazolecarbothioamide represents a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C4H4N2OS
InChI:InChI=1S/C4H4N2OS/c5-4(8)3-1-6-7-2-3/h1-2H,(H2,5,8)
InChI key:InChIKey=GWYHFVWUAHLFNY-UHFFFAOYSA-N
SMILES:C(N)(=S)C=1C=NOC1
Synonyms:
  • 4-Isoxazolecarbothioamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.