CAS 885274-95-3

1-(Phenylmethyl) 4-oxo-1,3-piperidinedicarboxylate

Description:

1-(Phenylmethyl) 4-oxo-1,3-piperidinedicarboxylate, identified by its CAS number 885274-95-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features two carboxylate groups and a phenylmethyl substituent, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the carbonyl group (oxo) indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Its molecular structure suggests that it may exhibit interesting biological activities, making it a candidate for further research in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its interactions in biological systems. Overall, 1-(Phenylmethyl) 4-oxo-1,3-piperidinedicarboxylate represents a complex organic molecule with potential utility in various chemical and pharmaceutical applications.

Formula: C₁₄H₁₅NO₅

InChI: InChI=1S/C14H15NO5/c16-12-6-7-15(8-11(12)13(17)18)14(19)20-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,18)

InChI key: InChIKey=QGBXHUMXBHMBKL-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(C(O)=O)C(=O)CC2

Synonyms:

• 1,3-Piperidinedicarboxylic acid, 4-oxo-, 1-(phenylmethyl) ester
• 1-(Phenylmethyl) 4-oxo-1,3-piperidinedicarboxylate
• 4-Oxo-Piperidine-1,3-Dicarboxylic Acid 1-Benzyl Ester