CAS 885275-02-5
:2-[4-(1-Piperazinyl)phenyl]benzoxazole
Description:
2-[4-(1-Piperazinyl)phenyl]benzoxazole, identified by its CAS number 885275-02-5, is a chemical compound characterized by its unique structure, which includes a benzoxazole moiety and a piperazine substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperazine ring suggests possible interactions with biological targets, particularly in the central nervous system, as piperazine derivatives are often explored for their pharmacological effects. The benzoxazole component may contribute to its stability and reactivity, influencing its behavior in various chemical environments. Additionally, this compound may exhibit fluorescence properties, which can be advantageous in imaging applications. Overall, 2-[4-(1-Piperazinyl)phenyl]benzoxazole represents a class of compounds that could have significant implications in drug development and therapeutic applications, although specific biological activities and mechanisms would require further investigation.
Formula:C17H17N3O
InChI:InChI=1S/C17H17N3O/c1-2-4-16-15(3-1)19-17(21-16)13-5-7-14(8-6-13)20-11-9-18-10-12-20/h1-8,18H,9-12H2
InChI key:InChIKey=LCMNDMOKEJXAOT-UHFFFAOYSA-N
SMILES:C1(=NC=2C(O1)=CC=CC2)C3=CC=C(C=C3)N4CCNCC4
Synonyms:- 2-[4-(1-Piperazinyl)phenyl]benzoxazole
- Benzoxazole, 2-[4-(1-piperazinyl)phenyl]-
- 2-(4-Piperazin-1-yl-phenyl)benzooxazole
- 2-[4-(Piperazin-1-yl)phenyl]-1,3-benzoxazole
- 2-(4-Piperazin-1-ylphenyl)-1,3-benzoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
