CAS 885275-04-7
:Pyrazolo[1,5-a]pyridine-2-carbothioamide
Description:
Pyrazolo[1,5-a]pyridine-2-carbothioamide is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine moieties. This compound features a thioamide functional group, which contributes to its reactivity and potential biological activity. Typically, compounds of this class exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of sulfur in the thioamide group can enhance the compound's ability to form hydrogen bonds, influencing its interactions with biological targets. Additionally, the structural arrangement allows for various substitution patterns, which can further modify its chemical properties and biological activity. Pyrazolo[1,5-a]pyridine derivatives are often investigated for their potential as anti-inflammatory, analgesic, or anticancer agents. The compound's solubility, stability, and reactivity can vary based on its specific substituents and the conditions under which it is studied. Overall, Pyrazolo[1,5-a]pyridine-2-carbothioamide represents a versatile scaffold in the development of new therapeutic agents.
Formula:C8H7N3S
InChI:InChI=1S/C8H7N3S/c9-8(12)7-5-6-3-1-2-4-11(6)10-7/h1-5H,(H2,9,12)
InChI key:InChIKey=LCEBCBUBVSMFKU-UHFFFAOYSA-N
SMILES:C(N)(=S)C=1C=C2N(N1)C=CC=C2
Synonyms:- Pyrazolo[1,5-A]Pyridine-2-Carbothioic Acid Amide
- PYRAZOLO[1,5-A]PYRIDINE-2-CARBOTHIOAMIDE
- Pyrazolo[1,5-a]pyridine-2-carbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
