CAS 885275-05-8

6-Fluoro-2-(2-piperidinyl)-1H-benzimidazole

Description:

6-Fluoro-2-(2-piperidinyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a fluorine atom and a piperidine group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity. The piperidine moiety contributes to the compound's potential as a pharmacophore, often associated with various biological activities, including interactions with neurotransmitter receptors. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological disorders or other therapeutic areas. Its molecular structure suggests potential for forming hydrogen bonds and engaging in π-π stacking interactions, which can be crucial for its binding affinity to biological targets. Additionally, the compound's solubility and stability can be influenced by the substituents on the benzimidazole ring and the piperidine nitrogen. Overall, 6-Fluoro-2-(2-piperidinyl)-1H-benzimidazole represents a class of compounds that may exhibit significant pharmacological properties, warranting further investigation in drug development.

Formula: C₁₂H₁₄FN₃

InChI: InChI=1S/C12H14FN3/c13-8-4-5-9-11(7-8)16-12(15-9)10-3-1-2-6-14-10/h4-5,7,10,14H,1-3,6H2,(H,15,16)

InChI key: InChIKey=WHFCKKIVCAMLFF-UHFFFAOYSA-N

SMILES: FC=1C=C2N=C(NC2=CC1)C3CCCCN3

Synonyms:

• 1H-Benzimidazole, 6-fluoro-2-(2-piperidinyl)-
• 1H-benzimidazole, 5-fluoro-2-(2-piperidinyl)-
• 5-fluoro-2-(piperidin-2-yl)-1H-benzimidazole
• 6-Fluoro-2-(2-piperidinyl)-1H-benzimidazole

5-Fluoro-2-piperidin-2-yl-1H-benzimidazole dihydrochloride

CAS: 885275-05-8

Formula: C₁₂H₁₄FN₃

Purity: %

Molecular weight: 219.2581

Ref: IN-DA0089GA