CAS 885275-09-2
:5-Bromo-2-(3-piperidinyl)benzoxazole
Description:
5-Bromo-2-(3-piperidinyl)benzoxazole is a chemical compound characterized by its unique structure, which includes a benzoxazole ring substituted with a bromine atom and a piperidine moiety. The presence of the bromine atom enhances its reactivity and can influence its biological activity. The benzoxazole core is known for its applications in pharmaceuticals and materials science due to its heterocyclic nature, which contributes to its electronic properties. The piperidine group, a six-membered ring containing nitrogen, is often associated with various biological activities, making this compound potentially relevant in medicinal chemistry. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or neuroprotective effects, although specific biological activities would depend on further empirical studies. Additionally, its solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug development and chemical synthesis. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H13BrN2O
InChI:InChI=1S/C12H13BrN2O/c13-9-3-4-11-10(6-9)15-12(16-11)8-2-1-5-14-7-8/h3-4,6,8,14H,1-2,5,7H2
InChI key:InChIKey=WGMCAXXDWZXUHA-UHFFFAOYSA-N
SMILES:BrC=1C=C2N=C(OC2=CC1)C3CCCNC3
Synonyms:- 5-Bromo-2-(3-piperidinyl)benzoxazole
- 5-Bromo-2-Piperidin-3-Yl-Benzooxazole
- Benzoxazole, 5-bromo-2-(3-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
