CymitQuimica logo

CAS 885275-19-4

:

1-[2-(4-Fluorophenyl)ethyl]-1H-pyrrole-2-methanol

Description:
1-[2-(4-Fluorophenyl)ethyl]-1H-pyrrole-2-methanol, with the CAS number 885275-19-4, is an organic compound characterized by its unique structure that combines a pyrrole ring with a phenyl group substituted by a fluorine atom. This compound features a hydroxymethyl group attached to the pyrrole, which can influence its reactivity and solubility. The presence of the fluorine atom typically enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The pyrrole moiety contributes to the compound's potential as a building block in the synthesis of various pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Overall, this compound's structural features suggest potential applications in drug development and materials science, although further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C13H14FNO
InChI:InChI=1S/C13H14FNO/c14-12-5-3-11(4-6-12)7-9-15-8-1-2-13(15)10-16/h1-6,8,16H,7,9-10H2
InChI key:InChIKey=HAFLNGXBEWOHCF-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(F)C=C1)N2C(CO)=CC=C2
Synonyms:
  • (1-[2-(4-Fluoro-Phenyl)-Ethyl]-1H-Pyrrol-2-Yl)-Methanol
  • 1-[2-(4-Fluorophenyl)ethyl]-1H-pyrrole-2-methanol
  • 1H-Pyrrole-2-methanol, 1-[2-(4-fluorophenyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.