CAS 885275-23-0
:1-(Phenylmethyl)-3-(2-propen-1-yl)-3-pyrrolidinol
Description:
1-(Phenylmethyl)-3-(2-propen-1-yl)-3-pyrrolidinol, identified by its CAS number 885275-23-0, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with both a phenylmethyl group and a propenyl group. This compound exhibits properties typical of amines and alcohols, including potential solubility in organic solvents and moderate polarity due to the presence of the hydroxyl group. The pyrrolidine ring contributes to its cyclic structure, which can influence its reactivity and interaction with biological systems. Additionally, the presence of the phenylmethyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. The propenyl substituent introduces a degree of unsaturation, which can participate in various chemical reactions, such as polymerization or addition reactions. Overall, this compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological activities or uses would require further investigation.
Formula:C14H19NO
InChI:InChI=1S/C14H19NO/c1-2-8-14(16)9-10-15(12-14)11-13-6-4-3-5-7-13/h2-7,16H,1,8-12H2
InChI key:InChIKey=GFMCKJRBQJHKMJ-UHFFFAOYSA-N
SMILES:C(N1CC(CC=C)(O)CC1)C2=CC=CC=C2
Synonyms:- 3-Pyrrolidinol, 1-(phenylmethyl)-3-(2-propenyl)-
- 3-Pyrrolidinol, 1-(phenylmethyl)-3-(2-propen-1-yl)-
- 1-(Phenylmethyl)-3-(2-propen-1-yl)-3-pyrrolidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
