
CAS 885275-28-5
:α-Propyl-2-pyrazinemethanamine
Description:
α-Propyl-2-pyrazinemethanamine, with the CAS number 885275-28-5, is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a propyl group and an amine functional group, contributing to its potential reactivity and solubility properties. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research and development. The presence of the pyrazine moiety can influence the compound's electronic properties and interactions with biological targets. Additionally, the amine group may participate in hydrogen bonding, affecting its solubility in various solvents. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, α-Propyl-2-pyrazinemethanamine represents a class of compounds that may have diverse applications in medicinal chemistry and related fields.
Formula:C8H13N3
InChI:InChI=1S/C8H13N3/c1-2-3-7(9)8-6-10-4-5-11-8/h4-7H,2-3,9H2,1H3
InChI key:InChIKey=GRCUTLOLHFPBBN-UHFFFAOYSA-N
SMILES:C(CCC)(N)C=1C=NC=CN1
Synonyms:- Pyrazinemethanamine, α-propyl-
- 2-Pyrazinemethanamine, α-propyl-
- α-Propyl-2-pyrazinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
